CAS 1353988-84-7
:1,1-Dimethylethyl N-[4-[(2-hydroxyethyl)amino]cyclohexyl]-N-(1-methylethyl)carbamate
Description:
1,1-Dimethylethyl N-[4-[(2-hydroxyethyl)amino]cyclohexyl]-N-(1-methylethyl)carbamate, identified by its CAS number 1353988-84-7, is a chemical compound characterized by its complex structure, which includes a carbamate functional group. This compound features a dimethyl group and a cyclohexyl moiety, contributing to its steric properties and potential biological activity. The presence of a hydroxyethylamino group suggests that it may exhibit solubility in polar solvents, which can influence its reactivity and interaction with biological systems. The compound's unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups indicates potential for hydrogen bonding, which can affect its stability and reactivity. Overall, this compound's characteristics suggest it may have applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation through empirical studies.
Formula:C16H32N2O3
InChI:InChI=1S/C16H32N2O3/c1-12(2)18(15(20)21-16(3,4)5)14-8-6-13(7-9-14)17-10-11-19/h12-14,17,19H,6-11H2,1-5H3
InChI key:InChIKey=ONSQWWIRQUCTIW-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(C(C)C)C1CCC(NCCO)CC1
Synonyms:- Carbamic acid, N-[4-[(2-hydroxyethyl)amino]cyclohexyl]-N-(1-methylethyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[4-[(2-hydroxyethyl)amino]cyclohexyl]-N-(1-methylethyl)carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.