CymitQuimica logo

CAS 1353989-44-2

:

2-Amino-N-cyclopropyl-N-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]acetamide

Description:
2-Amino-N-cyclopropyl-N-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]acetamide is a chemical compound characterized by its unique structural features, which include an amino group, a cyclopropyl moiety, and a pyrrole ring. This compound belongs to the class of amides and exhibits properties typical of such functional groups, including the potential for hydrogen bonding due to the presence of the amino and carbonyl groups. The cyclopropyl group contributes to its rigidity and may influence its biological activity and interaction with other molecules. The pyrrole ring adds to the compound's aromatic character, which can affect its electronic properties and reactivity. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological applications, as compounds with similar structures often exhibit bioactivity. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used. Overall, the combination of these structural elements suggests that 2-Amino-N-cyclopropyl-N-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]acetamide could have significant implications in various chemical and biological contexts.
Formula:C11H15N3O2
InChI:InChI=1S/C11H15N3O2/c12-6-11(16)14(8-3-4-8)7-10(15)9-2-1-5-13-9/h1-2,5,8,13H,3-4,6-7,12H2
InChI key:InChIKey=IXSWJRLEHRZDPW-UHFFFAOYSA-N
SMILES:N(CC(=O)C1=CC=CN1)(C(CN)=O)C2CC2
Synonyms:
  • 2-Amino-N-cyclopropyl-N-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]acetamide
  • Acetamide, 2-amino-N-cyclopropyl-N-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.