CAS 1353989-51-1

Phenylmethyl 3-(mercaptomethyl)-1-piperidinecarboxylate

Description:

Phenylmethyl 3-(mercaptomethyl)-1-piperidinecarboxylate is a chemical compound characterized by its unique structure, which includes a piperidine ring, a carboxylate group, and a mercaptomethyl substituent. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential basicity due to the piperidine nitrogen and reactivity from the carboxylate group. The presence of the mercaptomethyl group introduces thiol characteristics, which can enhance its reactivity and potential for forming disulfide bonds. The phenylmethyl moiety contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. Such compounds may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Additionally, the structural features suggest potential for various chemical reactions, including esterification and nucleophilic substitution. Overall, the compound's unique combination of functional groups makes it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₉NO₂S

InChI: InChI=1S/C14H19NO2S/c16-14(15-8-4-7-13(9-15)11-18)17-10-12-5-2-1-3-6-12/h1-3,5-6,13,18H,4,7-11H2

InChI key: InChIKey=ZJZDNKRSRWNIEQ-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CC(CS)CCC2

Synonyms:

• Phenylmethyl 3-(mercaptomethyl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-(mercaptomethyl)-, phenylmethyl ester