
CAS 1353989-68-0
:Pyrrolidine, 2-[[(4-chlorophenyl)sulfonyl]methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 2-[[(4-chlorophenyl)sulfonyl]methyl]-, hydrochloride (1:1), with the CAS number 1353989-68-0, is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 4-chlorophenyl group attached via a sulfonylmethyl linkage contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the chlorophenyl moiety may influence its lipophilicity and metabolic stability. Safety and handling precautions are essential, as with any chemical substance, particularly those with potential biological activity. Overall, this compound represents a specific class of sulfonamide derivatives that may have implications in drug development and research.
Formula:C11H14ClNO2S·ClH
InChI:InChI=1S/C11H14ClNO2S.ClH/c12-9-3-5-11(6-4-9)16(14,15)8-10-2-1-7-13-10;/h3-6,10,13H,1-2,7-8H2;1H
InChI key:InChIKey=TWXZIHYATLDXFA-UHFFFAOYSA-N
SMILES:S(CC1CCCN1)(=O)(=O)C2=CC=C(Cl)C=C2.Cl
Synonyms:- Pyrrolidine, 2-[[(4-chlorophenyl)sulfonyl]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(((4-Chlorophenyl)sulfonyl)methyl)pyrrolidine hydrochloride
CAS:Formula:C11H15Cl2NO2SMolecular weight:296.2133
