
CAS 1353989-72-6
:Benzonitrile, 4-[(methyl-3-piperidinylamino)methyl]-, hydrochloride (1:1)
Description:
Benzonitrile, 4-[(methyl-3-piperidinylamino)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzonitrile moiety and a piperidine-derived amine. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The piperidine ring contributes to its basicity and potential biological activity, making it of interest in medicinal chemistry. The presence of the nitrile group may also impart unique reactivity and properties, such as the ability to participate in nucleophilic reactions. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound's characteristics suggest potential applications in pharmaceutical research and development.
Formula:C14H19N3·ClH
InChI:InChI=1S/C14H19N3.ClH/c1-17(14-3-2-8-16-10-14)11-13-6-4-12(9-15)5-7-13;/h4-7,14,16H,2-3,8,10-11H2,1H3;1H
InChI key:InChIKey=XTTLDLVAYNSNDU-UHFFFAOYSA-N
SMILES:C(N(C)C1CCCNC1)C2=CC=C(C#N)C=C2.Cl
Synonyms:- Benzonitrile, 4-[(methyl-3-piperidinylamino)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-((Methyl(piperidin-3-yl)amino)methyl)benzonitrile hydrochloride
CAS:Formula:C14H20ClN3Molecular weight:265.7817
