CymitQuimica logo

CAS 1353989-92-0

:

1,1-Dimethylethyl 4-[[(4-methyl-2-pyridinyl)thio]methyl]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-[[(4-methyl-2-pyridinyl)thio]methyl]-1-piperidinecarboxylate, identified by its CAS number 1353989-92-0, is a chemical compound that features a complex structure incorporating a piperidine ring, a carboxylate group, and a thioether linkage with a pyridine derivative. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the dimethyl group contributes to steric hindrance, which can influence the compound's interaction with biological targets. Additionally, the pyridine moiety may enhance lipophilicity, affecting solubility and permeability. The thioether group can also play a role in the compound's reactivity and stability. Overall, this compound exemplifies the intricate design often found in drug development, where specific functional groups are strategically incorporated to optimize efficacy and selectivity in biological systems. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation.
Formula:C17H26N2O2S
InChI:InChI=1S/C17H26N2O2S/c1-13-5-8-18-15(11-13)22-12-14-6-9-19(10-7-14)16(20)21-17(2,3)4/h5,8,11,14H,6-7,9-10,12H2,1-4H3
InChI key:InChIKey=PHEXRGBGCAXELM-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(CSC2=CC(C)=CC=N2)CC1
Synonyms:
  • 1,1-Dimethylethyl 4-[[(4-methyl-2-pyridinyl)thio]methyl]-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-[[(4-methyl-2-pyridinyl)thio]methyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.