CAS 1353990-97-2
:1-(4-Phenyl-3-buten-1-yl)-4-piperidinol
Description:
1-(4-Phenyl-3-buten-1-yl)-4-piperidinol, identified by its CAS number 1353990-97-2, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenyl group and a butenyl side chain, contributing to its unique chemical properties. The presence of the hydroxyl group (-OH) on the piperidine ring suggests that it may exhibit alcohol-like characteristics, potentially influencing its solubility and reactivity. The compound's structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can affect its biological activity. Additionally, the presence of the phenyl group may enhance its lipophilicity, impacting its pharmacokinetic properties if considered for medicinal applications. Overall, 1-(4-Phenyl-3-buten-1-yl)-4-piperidinol is a compound of interest in organic synthesis and medicinal chemistry, warranting further investigation into its potential uses and effects.
Formula:C15H21NO
InChI:InChI=1S/C15H21NO/c17-15-9-12-16(13-10-15)11-5-4-8-14-6-2-1-3-7-14/h1-4,6-8,15,17H,5,9-13H2
InChI key:InChIKey=FXELTALWMJOIJT-UHFFFAOYSA-N
SMILES:C(CC=CC1=CC=CC=C1)N2CCC(O)CC2
Synonyms:- 1-(4-Phenyl-3-buten-1-yl)-4-piperidinol
- 4-Piperidinol, 1-(4-phenyl-3-buten-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.