CAS 1353993-87-9

(3R)-3-[(1-Methylethyl)(phenylmethyl)amino]-1-pyrrolidineethanol

Description:

The chemical substance known as (3R)-3-[(1-Methylethyl)(phenylmethyl)amino]-1-pyrrolidineethanol, with the CAS number 1353993-87-9, is characterized by its chiral pyrrolidine structure, which contributes to its potential biological activity. This compound features a tertiary amine group, indicating the presence of nitrogen that can participate in hydrogen bonding and influence solubility in various solvents. The presence of both isopropyl and benzyl substituents on the nitrogen atom suggests that it may exhibit lipophilic properties, which can affect its pharmacokinetics and interaction with biological membranes. Additionally, the hydroxyl group in the ethanol moiety can enhance its polarity and solubility in polar solvents, potentially impacting its bioavailability. The stereochemistry at the 3-position is crucial for its biological activity, as enantiomers can exhibit different pharmacological effects. Overall, this compound's unique structural features make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₁₆H₂₆N₂O

InChI: InChI=1S/C16H26N2O/c1-14(2)18(12-15-6-4-3-5-7-15)16-8-9-17(13-16)10-11-19/h3-7,14,16,19H,8-13H2,1-2H3/t16-/m1/s1

InChI key: InChIKey=RWTSLPHCOFWTFX-MRXNPFEDSA-N

SMILES: N(CC1=CC=CC=C1)(C(C)C)[C@H]2CN(CCO)CC2

Synonyms:

• (3R)-3-[(1-Methylethyl)(phenylmethyl)amino]-1-pyrrolidineethanol
• 1-Pyrrolidineethanol, 3-[(1-methylethyl)(phenylmethyl)amino]-, (3R)-