CAS 1353994-44-1
:(2S)-2-Amino-N-cyclopropyl-N-[2-oxo-2-(2-thienyl)ethyl]propanamide
Description:
(2S)-2-Amino-N-cyclopropyl-N-[2-oxo-2-(2-thienyl)ethyl]propanamide is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group, which contributes to its basicity and potential for forming hydrogen bonds. The presence of a cyclopropyl group introduces ring strain, influencing its reactivity and conformational properties. The thienyl moiety, a five-membered sulfur-containing ring, adds to the compound's aromatic character and may enhance its biological activity. The amide functional group indicates that the compound can participate in hydrogen bonding, affecting its solubility and interaction with biological targets. This compound is of interest in medicinal chemistry, potentially serving as a lead compound in drug development due to its unique structural features. Its specific stereochemistry (2S) is crucial for its biological activity, as stereoisomers can exhibit significantly different pharmacological profiles. Overall, the combination of these characteristics suggests that this compound may have specific applications in pharmacology or biochemistry, warranting further investigation into its properties and potential uses.
Formula:C12H16N2O2S
InChI:InChI=1S/C12H16N2O2S/c1-8(13)12(16)14(9-4-5-9)7-10(15)11-3-2-6-17-11/h2-3,6,8-9H,4-5,7,13H2,1H3/t8-/m0/s1
InChI key:InChIKey=ZAKZPZSXTLJXJF-QMMMGPOBSA-N
SMILES:N(CC(=O)C1=CC=CS1)(C([C@H](C)N)=O)C2CC2
Synonyms:- (2S)-2-Amino-N-cyclopropyl-N-[2-oxo-2-(2-thienyl)ethyl]propanamide
- Propanamide, 2-amino-N-cyclopropyl-N-[2-oxo-2-(2-thienyl)ethyl]-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.