CAS 1353994-67-8
:1-[(3R)-3-Iodo-1-piperidinyl]ethanone
Description:
1-[(3R)-3-Iodo-1-piperidinyl]ethanone is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the iodo substituent at the 3-position of the piperidine ring introduces significant polarity and can influence the compound's reactivity and biological activity. The ethanone functional group, which is a ketone, contributes to the compound's overall reactivity, particularly in nucleophilic addition reactions. This compound may exhibit specific stereochemistry due to the chiral center at the 3-position, which can affect its pharmacological properties and interactions with biological targets. Additionally, the presence of iodine can enhance the lipophilicity of the molecule, potentially impacting its absorption and distribution in biological systems. Overall, 1-[(3R)-3-Iodo-1-piperidinyl]ethanone is of interest in medicinal chemistry and may have applications in drug development, particularly in the design of compounds targeting various biological pathways.
Formula:C7H12INO
InChI:InChI=1S/C7H12INO/c1-6(10)9-4-2-3-7(8)5-9/h7H,2-5H2,1H3/t7-/m1/s1
InChI key:InChIKey=JNSKHASSNNUWAF-SSDOTTSWSA-N
SMILES:C(C)(=O)N1C[C@H](I)CCC1
Synonyms:- 1-[(3R)-3-Iodo-1-piperidinyl]ethanone
- Ethanone, 1-[(3R)-3-iodo-1-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.