CAS 1353995-05-7
:Phenylmethyl (2S)-2-[[(2-aminoacetyl)methylamino]methyl]-1-pyrrolidinecarboxylate
Description:
Phenylmethyl (2S)-2-[[(2-aminoacetyl)methylamino]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1353995-05-7, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a carboxylate functional group, an aminoacetyl moiety, and a phenylmethyl group, contributing to its structural complexity. The stereochemistry indicated by the (2S) designation suggests that it has specific spatial arrangements that can influence its biological activity and interactions. Such compounds often exhibit properties relevant to medicinal chemistry, potentially acting as intermediates in drug synthesis or as bioactive molecules. The presence of both amino and carboxylate functionalities suggests that it may participate in various chemical reactions, including peptide bond formation or interactions with biological targets. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in research and development within the pharmaceutical field.
Formula:C16H23N3O3
InChI:InChI=1S/C16H23N3O3/c1-18(15(20)10-17)11-14-8-5-9-19(14)16(21)22-12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12,17H2,1H3/t14-/m0/s1
InChI key:InChIKey=XJLXCVZSFIVJMR-AWEZNQCLSA-N
SMILES:C(N(C(CN)=O)C)[C@H]1N(C(OCC2=CC=CC=C2)=O)CCC1
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-[[(2-aminoacetyl)methylamino]methyl]-, phenylmethyl ester, (2S)-
- Phenylmethyl (2S)-2-[[(2-aminoacetyl)methylamino]methyl]-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.