CAS 1353995-32-0

1,1-Dimethylethyl (3R)-3-chloro-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3R)-3-chloro-1-piperidinecarboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a chloro substituent at the 3-position of the piperidine ring contributes to its reactivity and potential biological activity. The dimethyl group at the 1-position enhances steric hindrance, which can influence the compound's interactions with biological targets. This compound is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine moiety's prevalence in drug design. Additionally, the presence of the carboxylate functional group may impart acidic properties, affecting its solubility and reactivity in various chemical environments. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks depending on exposure levels.

Formula: C₁₀H₁₈ClNO₂

InChI: InChI=1S/C10H18ClNO2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7H2,1-3H3/t8-/m1/s1

InChI key: InChIKey=JPSPBVBCTKBAEJ-MRVPVSSYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C[C@H](Cl)CCC1

Synonyms:

• 1-Piperidinecarboxylic acid, 3-chloro-, 1,1-dimethylethyl ester, (3R)-
• 1,1-Dimethylethyl (3R)-3-chloro-1-piperidinecarboxylate