CAS 1353995-56-8

(2S)-2-Amino-N-[(2,6-dichlorophenyl)methyl]-3-methylbutanamide

Description:

(2S)-2-Amino-N-[(2,6-dichlorophenyl)methyl]-3-methylbutanamide, identified by its CAS number 1353995-56-8, is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group (-NH2) and an amide linkage, which are indicative of its potential biological activity. The presence of a 2,6-dichlorophenyl group suggests that it may exhibit significant lipophilicity, potentially influencing its interaction with biological membranes and receptors. The compound's structure includes a branched alkyl chain, which can affect its steric properties and solubility. As a chiral molecule, it exists in a specific stereoisomeric form, which can be crucial for its pharmacological properties. Such compounds are often studied for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development. Overall, the unique combination of functional groups and stereochemistry in this compound may contribute to its reactivity and biological significance.

Formula: C₁₂H₁₆Cl₂N₂O

InChI: InChI=1S/C12H16Cl2N2O/c1-7(2)11(15)12(17)16-6-8-9(13)4-3-5-10(8)14/h3-5,7,11H,6,15H2,1-2H3,(H,16,17)/t11-/m0/s1

InChI key: InChIKey=AGLAZYNNNCSGAK-NSHDSACASA-N

SMILES: C(NC([C@H](C(C)C)N)=O)C1=C(Cl)C=CC=C1Cl

Synonyms:

• Butanamide, 2-amino-N-[(2,6-dichlorophenyl)methyl]-3-methyl-, (2S)-
• (2S)-2-Amino-N-[(2,6-dichlorophenyl)methyl]-3-methylbutanamide