CAS 1353996-79-8

2-[Ethyl[(3R)-1-(phenylmethyl)-3-pyrrolidinyl]amino]ethanol

Description:

2-[Ethyl[(3R)-1-(phenylmethyl)-3-pyrrolidinyl]amino]ethanol, with the CAS number 1353996-79-8, is a chemical compound characterized by its complex structure, which includes an ethyl group, a pyrrolidine ring, and a phenylmethyl substituent. This compound features a chiral center at the pyrrolidine moiety, indicating that it can exist in different stereoisomeric forms, which may influence its biological activity and pharmacological properties. The presence of the amino and hydroxyl functional groups suggests that it may engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound's structure implies potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound may have applications in drug development, particularly in areas targeting neurological or psychiatric conditions, given the presence of the pyrrolidine structure often associated with such therapeutic effects.

Formula: C₁₅H₂₄N₂O

InChI: InChI=1S/C15H24N2O/c1-2-17(10-11-18)15-8-9-16(13-15)12-14-6-4-3-5-7-14/h3-7,15,18H,2,8-13H2,1H3/t15-/m1/s1

InChI key: InChIKey=NREMRULTNGFOCR-OAHLLOKOSA-N

SMILES: N(CCO)(CC)[C@H]1CN(CC2=CC=CC=C2)CC1

Synonyms:

• Ethanol, 2-[ethyl[(3R)-1-(phenylmethyl)-3-pyrrolidinyl]amino]-
• 2-[Ethyl[(3R)-1-(phenylmethyl)-3-pyrrolidinyl]amino]ethanol