CymitQuimica logo

CAS 1353996-83-4

:

(2S)-2-Amino-N-ethyl-3-methyl-N-[(4-nitrophenyl)methyl]butanamide

Description:
(2S)-2-Amino-N-ethyl-3-methyl-N-[(4-nitrophenyl)methyl]butanamide is a synthetic organic compound characterized by its specific stereochemistry and functional groups. The presence of an amino group (-NH2) indicates its classification as an amine, while the butanamide structure suggests it is a derivative of butanoic acid with an amide functional group. The compound features an ethyl group and a methyl group attached to the nitrogen, contributing to its overall hydrophobic character. The 4-nitrophenylmethyl substituent introduces a nitro group, which is known for its electron-withdrawing properties, potentially influencing the compound's reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stereochemistry, particularly the (2S) configuration, is crucial for its interaction with biological targets, as stereoisomers can have significantly different properties and activities. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and biochemistry, warranting further investigation into its properties and effects.
Formula:C14H21N3O3
InChI:InChI=1S/C14H21N3O3/c1-4-16(14(18)13(15)10(2)3)9-11-5-7-12(8-6-11)17(19)20/h5-8,10,13H,4,9,15H2,1-3H3/t13-/m0/s1
InChI key:InChIKey=HOBBLWIDLWOIOA-ZDUSSCGKSA-N
SMILES:N(CC1=CC=C(N(=O)=O)C=C1)(C([C@H](C(C)C)N)=O)CC
Synonyms:
  • (2S)-2-Amino-N-ethyl-3-methyl-N-[(4-nitrophenyl)methyl]butanamide
  • Butanamide, 2-amino-N-ethyl-3-methyl-N-[(4-nitrophenyl)methyl]-, (2S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.