CAS 1353996-93-6
:N-[(3R)-1-Acetyl-3-piperidinyl]-N-(1-methylethyl)glycine
Description:
N-[(3R)-1-Acetyl-3-piperidinyl]-N-(1-methylethyl)glycine is a chemical compound characterized by its specific structural features, which include a piperidine ring and an acetyl group. This compound belongs to the class of amino acids, specifically a derivative of glycine, and is notable for its potential biological activity. The presence of the piperidine moiety suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or exhibiting pharmacological properties. The compound's stereochemistry, indicated by the (3R) configuration, is crucial for its biological activity, as stereoisomers can exhibit significantly different effects in biological systems. Additionally, the presence of the isopropyl group contributes to its lipophilicity, which may affect its absorption and distribution in biological systems. Overall, this compound's unique structural characteristics position it as a subject of interest in medicinal chemistry and pharmacology, potentially leading to applications in drug development or therapeutic interventions.
Formula:C12H22N2O3
InChI:InChI=1S/C12H22N2O3/c1-9(2)14(8-12(16)17)11-5-4-6-13(7-11)10(3)15/h9,11H,4-8H2,1-3H3,(H,16,17)/t11-/m1/s1
InChI key:InChIKey=PHQWAHQGJISWNT-LLVKDONJSA-N
SMILES:N(CC(O)=O)(C(C)C)[C@H]1CN(C(C)=O)CCC1
Synonyms:- N-[(3R)-1-Acetyl-3-piperidinyl]-N-(1-methylethyl)glycine
- Glycine, N-[(3R)-1-acetyl-3-piperidinyl]-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.