CymitQuimica logo

CAS 1353996-97-0

:

N-[(3S)-1-(2-Chloroacetyl)-3-piperidinyl]acetamide

Description:
N-[(3S)-1-(2-Chloroacetyl)-3-piperidinyl]acetamide is a chemical compound characterized by its specific structural features, including a piperidine ring and an acetamide functional group. The presence of a chloroacetyl group introduces a halogen, which can influence the compound's reactivity and biological activity. This compound is typically classified as an amide due to the presence of the acetamide moiety, which can participate in hydrogen bonding, affecting its solubility and interaction with biological targets. The stereochemistry indicated by the (3S) designation suggests that the compound has a specific three-dimensional arrangement, which is crucial for its potential pharmacological properties. Such compounds often exhibit significant activity in medicinal chemistry, particularly in the development of therapeutics targeting various biological pathways. The CAS number 1353996-97-0 uniquely identifies this substance, facilitating its recognition in scientific literature and databases. Overall, the characteristics of this compound make it of interest in both synthetic chemistry and pharmacology.
Formula:C9H15ClN2O2
InChI:InChI=1S/C9H15ClN2O2/c1-7(13)11-8-3-2-4-12(6-8)9(14)5-10/h8H,2-6H2,1H3,(H,11,13)/t8-/m0/s1
InChI key:InChIKey=YDHPTUBYYCDODX-QMMMGPOBSA-N
SMILES:C(CCl)(=O)N1C[C@@H](NC(C)=O)CCC1
Synonyms:
  • Acetamide, N-[(3S)-1-(2-chloroacetyl)-3-piperidinyl]-
  • N-[(3S)-1-(2-Chloroacetyl)-3-piperidinyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.