CymitQuimica logo

CAS 1353997-03-1

:

N-[[(2S)-1-(2-Chloroacetyl)-2-pyrrolidinyl]methyl]-N-ethylacetamide

Description:
N-[[(2S)-1-(2-Chloroacetyl)-2-pyrrolidinyl]methyl]-N-ethylacetamide is a chemical compound characterized by its specific structural features, including a pyrrolidine ring and an acetamide functional group. The presence of a chloroacetyl moiety contributes to its reactivity and potential biological activity. This compound is typically classified as a small organic molecule and may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological targets due to its amide and chloroacetyl groups. Its stereochemistry, indicated by the (2S) configuration, suggests that it may have specific spatial arrangements that could influence its pharmacological properties. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its characteristics and potential uses in various applications.
Formula:C11H19ClN2O2
InChI:InChI=1S/C11H19ClN2O2/c1-3-13(9(2)15)8-10-5-4-6-14(10)11(16)7-12/h10H,3-8H2,1-2H3/t10-/m0/s1
InChI key:InChIKey=YDUWKSOTAQVEBG-JTQLQIEISA-N
SMILES:C(N(C(C)=O)CC)[C@H]1N(C(CCl)=O)CCC1
Synonyms:
  • N-[[(2S)-1-(2-Chloroacetyl)-2-pyrrolidinyl]methyl]-N-ethylacetamide
  • Acetamide, N-[[(2S)-1-(2-chloroacetyl)-2-pyrrolidinyl]methyl]-N-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.