CAS 1353997-37-1
:(2S)-2-Amino-N-cyclopropyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]propanamide
Description:
(2S)-2-Amino-N-cyclopropyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]propanamide, with CAS number 1353997-37-1, is a chemical compound characterized by its complex structure, which includes an amino group, a cyclopropyl moiety, and a piperidine ring. This compound is classified as an amide due to the presence of the carbonyl group adjacent to the nitrogen atoms. Its stereochemistry is significant, as indicated by the (2S) designation, which refers to the specific spatial arrangement of atoms around the chiral center. The presence of the phenylmethyl group contributes to its lipophilicity, potentially influencing its biological activity and interactions with various receptors. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutics targeting the central nervous system. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species, which are important considerations in both laboratory and clinical settings.
Formula:C19H29N3O
InChI:InChI=1S/C19H29N3O/c1-15(20)19(23)22(18-7-8-18)14-17-9-11-21(12-10-17)13-16-5-3-2-4-6-16/h2-6,15,17-18H,7-14,20H2,1H3/t15-/m0/s1
InChI key:InChIKey=QCSCPHLSQCRQRO-HNNXBMFYSA-N
SMILES:N(CC1CCN(CC2=CC=CC=C2)CC1)(C([C@H](C)N)=O)C3CC3
Synonyms:- Propanamide, 2-amino-N-cyclopropyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]-, (2S)-
- (2S)-2-Amino-N-cyclopropyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.