CAS 1353997-59-7

2-[Cyclopropyl[(3R)-1-methyl-3-pyrrolidinyl]amino]ethanol

Description:

2-[Cyclopropyl[(3R)-1-methyl-3-pyrrolidinyl]amino]ethanol, with the CAS number 1353997-59-7, is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a pyrrolidine moiety. This compound is classified as an amino alcohol, indicating the presence of both an amino group and a hydroxyl group in its structure. The cyclopropyl group contributes to its rigidity and may influence its biological activity, while the pyrrolidine ring, particularly in the (3R) configuration, suggests potential interactions with biological targets, possibly in the central nervous system. The presence of the ethanol moiety indicates that it can participate in hydrogen bonding, which may enhance its solubility in polar solvents. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific interactions and effects would depend on further studies, including its binding affinity to various receptors and its metabolic stability.

Formula: C₁₀H₂₀N₂O

InChI: InChI=1S/C10H20N2O/c1-11-5-4-10(8-11)12(6-7-13)9-2-3-9/h9-10,13H,2-8H2,1H3/t10-/m1/s1

InChI key: InChIKey=ZBKIAJLPTSNQOW-SNVBAGLBSA-N

SMILES: N(CCO)([C@H]1CN(C)CC1)C2CC2

Synonyms:

• 2-[Cyclopropyl[(3R)-1-methyl-3-pyrrolidinyl]amino]ethanol
• Ethanol, 2-[cyclopropyl[(3R)-1-methyl-3-pyrrolidinyl]amino]-