CAS 1353997-95-1

2-[Methyl[(3R)-1-methyl-3-pyrrolidinyl]amino]ethanol

Description:

2-[Methyl[(3R)-1-methyl-3-pyrrolidinyl]amino]ethanol, with the CAS number 1353997-95-1, is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and an ethanol moiety. This compound is classified as an amino alcohol, indicating the presence of both an amino group and a hydroxyl group in its structure. The pyrrolidine ring contributes to its potential biological activity, as cyclic amines often exhibit interesting pharmacological properties. The stereochemistry of the compound, particularly the (3R) configuration, suggests that it may interact with biological targets in a specific manner, potentially influencing its efficacy and safety profile. Additionally, the presence of a methyl group attached to the nitrogen atom can affect the compound's lipophilicity and solubility, which are critical factors in drug design and development. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and pharmacology, particularly in the context of developing new therapeutic agents.

Formula: C₈H₁₈N₂O

InChI: InChI=1S/C8H18N2O/c1-9-4-3-8(7-9)10(2)5-6-11/h8,11H,3-7H2,1-2H3/t8-/m1/s1

InChI key: InChIKey=OQEQNHAHYAUMLY-MRVPVSSYSA-N

SMILES: N(CCO)(C)[C@@H]1CCN(C)C1

Synonyms:

• 2-[Methyl[(3R)-1-methyl-3-pyrrolidinyl]amino]ethanol
• Ethanol, 2-[methyl[(3R)-1-methyl-3-pyrrolidinyl]amino]-