CAS 1353998-18-1: 1,1-Dimethylethyl (3R)-3-[(2-chloroacetyl)ethylamino]-1-pyrrolidinecarboxylate
Description:1,1-Dimethylethyl (3R)-3-[(2-chloroacetyl)ethylamino]-1-pyrrolidinecarboxylate, identified by its CAS number 1353998-18-1, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and various functional groups. The presence of a dimethyl group contributes to its steric bulk, while the chloroacetyl and ethylamino substituents introduce reactivity and potential for biological activity. This compound may exhibit properties typical of amides and esters, such as solubility in organic solvents and potential interactions with biological systems. Its chirality at the pyrrolidine ring suggests that it may have specific stereochemical properties that could influence its pharmacological profile. As with many organic compounds, its stability, reactivity, and interactions depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties, including its potential applications in medicinal chemistry or other fields.
Formula:C13H23ClN2O3
InChI:InChI=1S/C13H23ClN2O3/c1-5-16(11(17)8-14)10-6-7-15(9-10)12(18)19-13(2,3)4/h10H,5-9H2,1-4H3/t10-/m1/s1
InChI key:InChIKey=OTZYBKCXUPUDMP-SNVBAGLBSA-N
SMILES:O=C(OC(C)(C)C)N1CCC(N(C(=O)CCl)CC)C1
- Synonyms:
- 1,1-Dimethylethyl (3R)-3-[(2-chloroacetyl)ethylamino]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-[(2-chloroacetyl)ethylamino]-, 1,1-dimethylethyl ester, (3R)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (R)-3-[(2-Chloro-acetyl)-ethyl-amino]-pyrrolidine-1-carboxylic acid tert-butyl ester REF: 10-F081403CAS: 1353998-18-1 | - - - | - - - | Discontinued product |
![]() | (R)-3-[(2-Chloro-acetyl)-ethyl-amino]-pyrrolidine-1-carboxylic acid tert-butyl ester REF: 3D-DEC99818CAS: 1353998-18-1 | Min. 95% | - - - | Discontinued product |

(R)-3-[(2-Chloro-acetyl)-ethyl-amino]-pyrrolidine-1-carboxylic acid tert-butyl ester
Ref: 10-F081403
500mg | Discontinued | Request information |

(R)-3-[(2-Chloro-acetyl)-ethyl-amino]-pyrrolidine-1-carboxylic acid tert-butyl ester
Ref: 3D-DEC99818
1g | Discontinued | Request information |