CAS 1353999-44-6

1,1-Dimethylethyl N-cyclopropyl-N-[(2S)-2-pyrrolidinylmethyl]carbamate

Description:

1,1-Dimethylethyl N-cyclopropyl-N-[(2S)-2-pyrrolidinylmethyl]carbamate, with the CAS number 1353999-44-6, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a pyrrolidine moiety. This compound typically exhibits properties associated with both its hydrophobic and hydrophilic regions, influencing its solubility and reactivity. The presence of the cyclopropyl group contributes to its steric properties, potentially affecting its biological activity and interaction with other molecules. As a carbamate, it may exhibit characteristics such as stability under various conditions and potential reactivity with nucleophiles. The stereochemistry of the pyrrolidine ring can also play a significant role in its pharmacological profile, making it of interest in medicinal chemistry. Overall, this compound's unique combination of functional groups and structural features suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₃H₂₄N₂O₂

InChI: InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)15(11-6-7-11)9-10-5-4-8-14-10/h10-11,14H,4-9H2,1-3H3/t10-/m0/s1

InChI key: InChIKey=NHOZVDBUVVIVHY-JTQLQIEISA-N

SMILES: N(C[C@@H]1CCCN1)(C(OC(C)(C)C)=O)C2CC2

Synonyms:

• 1,1-Dimethylethyl N-cyclopropyl-N-[(2S)-2-pyrrolidinylmethyl]carbamate
• Carbamic acid, N-cyclopropyl-N-[(2S)-2-pyrrolidinylmethyl]-, 1,1-dimethylethyl ester