CAS 1354000-04-6

4-Pyrimidinamine, N,N-diethyl-6-[(3S)-3-pyrrolidinyloxy]-, hydrochloride (1:1)

Description:

4-Pyrimidinamine, N,N-diethyl-6-[(3S)-3-pyrrolidinyloxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a diethylamino group, enhancing its solubility and potential biological activity. The presence of the pyrrolidine moiety, specifically in the (3S) configuration, suggests that it may exhibit chiral properties, which can influence its interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. The compound may possess various pharmacological activities, potentially acting as an inhibitor or modulator in biological pathways. Its specific interactions and effects would depend on its molecular structure and the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₂H₂₀N₄O·ClH

InChI: InChI=1S/C12H20N4O.ClH/c1-3-16(4-2)11-7-12(15-9-14-11)17-10-5-6-13-8-10;/h7,9-10,13H,3-6,8H2,1-2H3;1H/t10-;/m0./s1

InChI key: InChIKey=DISQSHHLYBOVLY-PPHPATTJSA-N

SMILES: N(CC)(CC)C=1C=C(O[C@H]2CCNC2)N=CN1.Cl

Synonyms:

• 4-Pyrimidinamine, N,N-diethyl-6-[(3S)-3-pyrrolidinyloxy]-, hydrochloride (1:1)