CAS 1354000-09-1

(2S)-2-Amino-N-methyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]propanamide

Description:

(2S)-2-Amino-N-methyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]propanamide, identified by its CAS number 1354000-09-1, is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group, a methyl group, and a propanamide backbone, which contribute to its potential biological activity. The presence of a piperidine ring, substituted with a phenylmethyl group, suggests that this compound may interact with various biological targets, possibly influencing neurotransmitter systems. Its stereochemistry, indicated by the (2S) designation, is crucial for its pharmacological properties, as the spatial arrangement of atoms can significantly affect the compound's interaction with receptors. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutics targeting neurological conditions. Additionally, its solubility, stability, and reactivity would be influenced by the functional groups present, making it a candidate for further investigation in drug design and synthesis.

Formula: C₁₇H₂₇N₃O

InChI: InChI=1S/C17H27N3O/c1-14(18)17(21)19(2)12-16-8-10-20(11-9-16)13-15-6-4-3-5-7-15/h3-7,14,16H,8-13,18H2,1-2H3/t14-/m0/s1

InChI key: InChIKey=AXAUIOKNEDSOPZ-AWEZNQCLSA-N

SMILES: C(N1CCC(CN(C([C@H](C)N)=O)C)CC1)C2=CC=CC=C2

Synonyms:

• (2S)-2-Amino-N-methyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]propanamide
• Propanamide, 2-amino-N-methyl-N-[[1-(phenylmethyl)-4-piperidinyl]methyl]-, (2S)-