CAS 1354000-18-2
:2-Amino-N-(1-methylethyl)-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]acetamide
Description:
2-Amino-N-(1-methylethyl)-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]acetamide, identified by its CAS number 1354000-18-2, is a chemical compound that belongs to the class of amino acids and amides. This substance features a complex structure characterized by an acetamide group, an isopropyl substituent, and a piperidine ring with a phenylmethyl group. Its molecular structure suggests potential biological activity, particularly in pharmacology, where it may interact with various receptors or enzymes. The presence of the amino group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. Additionally, the stereochemistry of the piperidine ring, denoted by the (3R) configuration, may play a crucial role in its biological interactions and efficacy. Overall, this compound's unique structural features make it a subject of interest for research in medicinal chemistry and drug development. However, specific properties such as solubility, melting point, and biological activity would require empirical data for comprehensive characterization.
Formula:C17H27N3O
InChI:InChI=1S/C17H27N3O/c1-14(2)20(17(21)11-18)16-9-6-10-19(13-16)12-15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,9-13,18H2,1-2H3/t16-/m1/s1
InChI key:InChIKey=MSXANNZUDCQRGW-MRXNPFEDSA-N
SMILES:N(C(CN)=O)(C(C)C)[C@H]1CN(CC2=CC=CC=C2)CCC1
Synonyms:- 2-Amino-N-(1-methylethyl)-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]acetamide
- Acetamide, 2-amino-N-(1-methylethyl)-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.