CAS 1354000-25-1

(2S)-2-Amino-N,3-dimethyl-N-[1-(phenylmethyl)-4-piperidinyl]butanamide

Description:

(2S)-2-Amino-N,3-dimethyl-N-[1-(phenylmethyl)-4-piperidinyl]butanamide, with CAS number 1354000-25-1, is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group, which contributes to its basicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The presence of a butanamide backbone indicates that it is an amide, which typically exhibits moderate stability and can participate in various chemical reactions, including hydrolysis. The dimethyl and phenylmethyl substituents on the piperidine ring suggest that this compound may exhibit significant lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the piperidine moiety is known for its role in biological activity, often associated with neurotransmitter modulation. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. Its specific stereochemistry may also play a crucial role in its biological activity and interaction with receptors.

Formula: C₁₈H₂₉N₃O

InChI: InChI=1S/C18H29N3O/c1-14(2)17(19)18(22)20(3)16-9-11-21(12-10-16)13-15-7-5-4-6-8-15/h4-8,14,16-17H,9-13,19H2,1-3H3/t17-/m0/s1

InChI key: InChIKey=KFJWLVAONFBULE-KRWDZBQOSA-N

SMILES: N(C([C@H](C(C)C)N)=O)(C)C1CCN(CC2=CC=CC=C2)CC1

Synonyms:

• Butanamide, 2-amino-N,3-dimethyl-N-[1-(phenylmethyl)-4-piperidinyl]-, (2S)-
• (2S)-2-Amino-N,3-dimethyl-N-[1-(phenylmethyl)-4-piperidinyl]butanamide