CAS 1354000-40-0
:(3S)-N-Cyclopropyl-1-methyl-3-piperidinamine
Description:
(3S)-N-Cyclopropyl-1-methyl-3-piperidinamine is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The presence of a cyclopropyl group and a methyl group at specific positions contributes to its unique properties. This compound is typically classified as an amine due to the presence of the amino group (-NH) in its structure. Its stereochemistry is indicated by the (3S) designation, suggesting that it has a specific three-dimensional arrangement that can influence its biological activity and interactions. Such compounds often exhibit potential pharmacological properties, making them of interest in medicinal chemistry. The molecular interactions, solubility, and reactivity can vary significantly based on the substituents and their spatial orientation. As with many piperidine derivatives, this compound may be investigated for its effects on neurotransmitter systems, potentially impacting areas such as anxiety, depression, or other neurological conditions. However, specific biological activity and safety profiles would require further empirical research and analysis.
Formula:C9H18N2
InChI:InChI=1S/C9H18N2/c1-11-6-2-3-9(7-11)10-8-4-5-8/h8-10H,2-7H2,1H3/t9-/m0/s1
InChI key:InChIKey=CANKZASBOVHULO-VIFPVBQESA-N
SMILES:N(C1CC1)[C@@H]2CN(C)CCC2
Synonyms:- 3-Piperidinamine, N-cyclopropyl-1-methyl-, (3S)-
- (3S)-N-Cyclopropyl-1-methyl-3-piperidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.