CAS 1354000-93-3
:2-Chloro-1-[(3S)-3-[methyl(1-methylethyl)amino]-1-pyrrolidinyl]ethanone
Description:
2-Chloro-1-[(3S)-3-[methyl(1-methylethyl)amino]-1-pyrrolidinyl]ethanone, with the CAS number 1354000-93-3, is a chemical compound characterized by its unique structural features, including a chloro substituent and a pyrrolidine ring. This compound exhibits properties typical of amines and ketones, including potential basicity due to the presence of the amino group and reactivity associated with the carbonyl group. The stereochemistry indicated by the (3S) designation suggests that it has a specific three-dimensional arrangement, which can influence its biological activity and interactions. The presence of the methyl and isopropyl groups contributes to its hydrophobic characteristics, potentially affecting its solubility in various solvents. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural motifs that can interact with biological targets. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used.
Formula:C10H19ClN2O
InChI:InChI=1S/C10H19ClN2O/c1-8(2)12(3)9-4-5-13(7-9)10(14)6-11/h8-9H,4-7H2,1-3H3/t9-/m0/s1
InChI key:InChIKey=VKNKXPWNONYFMY-VIFPVBQESA-N
SMILES:N(C(C)C)(C)[C@@H]1CN(C(CCl)=O)CC1
Synonyms:- 2-Chloro-1-[(3S)-3-[methyl(1-methylethyl)amino]-1-pyrrolidinyl]ethanone
- Ethanone, 2-chloro-1-[(3S)-3-[methyl(1-methylethyl)amino]-1-pyrrolidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.