CAS 1354001-75-4
:N-[1-[(2S)-2-Amino-3-methyl-1-oxobutyl]-4-piperidinyl]-N-cyclopropylacetamide
Description:
N-[1-[(2S)-2-Amino-3-methyl-1-oxobutyl]-4-piperidinyl]-N-cyclopropylacetamide, with CAS number 1354001-75-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a cyclopropylacetamide moiety. This compound features an amino acid derivative, specifically incorporating a 2-amino-3-methyl-1-oxobutyl group, which contributes to its potential biological activity. The presence of the piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its structural features may influence its solubility, stability, and reactivity, which are critical for its application in pharmaceutical development. Additionally, the stereochemistry indicated by the (2S) configuration suggests specific spatial arrangements that can affect the compound's pharmacodynamics and pharmacokinetics. Overall, this compound's unique characteristics position it as a candidate for further research, particularly in the context of drug discovery and development.
Formula:C15H27N3O2
InChI:InChI=1S/C15H27N3O2/c1-10(2)14(16)15(20)17-8-6-13(7-9-17)18(11(3)19)12-4-5-12/h10,12-14H,4-9,16H2,1-3H3/t14-/m0/s1
InChI key:InChIKey=NVDYYJKWIWLRDA-AWEZNQCLSA-N
SMILES:N(C(C)=O)(C1CC1)C2CCN(C([C@H](C(C)C)N)=O)CC2
Synonyms:- Acetamide, N-[1-[(2S)-2-amino-3-methyl-1-oxobutyl]-4-piperidinyl]-N-cyclopropyl-
- N-[1-[(2S)-2-Amino-3-methyl-1-oxobutyl]-4-piperidinyl]-N-cyclopropylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.