CymitQuimica logo

CAS 1354002-64-4

:

N-Ethyl-N-[(3R)-1-methyl-3-piperidinyl]glycine

Description:
N-Ethyl-N-[(3R)-1-methyl-3-piperidinyl]glycine, identified by its CAS number 1354002-64-4, is a chemical compound that belongs to the class of amino acids and derivatives. It features a piperidine ring, which contributes to its structural complexity and potential biological activity. The presence of the ethyl group and the specific stereochemistry at the piperidine nitrogen indicates that this compound may exhibit unique pharmacological properties, possibly influencing neurotransmitter systems. Its molecular structure suggests it may interact with receptors in the central nervous system, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are important factors for its application in research or therapeutic contexts. As with many compounds in this category, understanding its mechanism of action and potential side effects would be crucial for evaluating its safety and efficacy in any proposed use.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-3-12(8-10(13)14)9-5-4-6-11(2)7-9/h9H,3-8H2,1-2H3,(H,13,14)/t9-/m1/s1
InChI key:InChIKey=IFMJEFXWVZNZQO-SECBINFHSA-N
SMILES:N(CC(O)=O)(CC)[C@H]1CN(C)CCC1
Synonyms:
  • Glycine, N-ethyl-N-[(3R)-1-methyl-3-piperidinyl]-
  • N-Ethyl-N-[(3R)-1-methyl-3-piperidinyl]glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.