CAS 1354002-74-6
:N-[(3R)-1-Methyl-3-pyrrolidinyl]glycine
Description:
N-[(3R)-1-Methyl-3-pyrrolidinyl]glycine, identified by its CAS number 1354002-74-6, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a glycine moiety. This compound is a derivative of glycine, an amino acid, and features a methyl group attached to the nitrogen of the pyrrolidine ring, which contributes to its stereochemistry and potential biological activity. The (3R) configuration indicates that the compound has specific spatial arrangements that can influence its interaction with biological targets, such as receptors or enzymes. N-[(3R)-1-Methyl-3-pyrrolidinyl]glycine may exhibit properties relevant to pharmacology, particularly in the context of neurochemistry, due to its structural similarities to neurotransmitters or modulators. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound is of interest in research related to medicinal chemistry and the development of therapeutic agents.
Formula:C7H14N2O2
InChI:InChI=1S/C7H14N2O2/c1-9-3-2-6(5-9)8-4-7(10)11/h6,8H,2-5H2,1H3,(H,10,11)/t6-/m1/s1
InChI key:InChIKey=UDYWCMMOFZAUNY-ZCFIWIBFSA-N
SMILES:N(CC(O)=O)[C@H]1CN(C)CC1
Synonyms:- Glycine, N-[(3R)-1-methyl-3-pyrrolidinyl]-
- N-[(3R)-1-Methyl-3-pyrrolidinyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.