CAS 1354003-53-4
:2-Chloro-N-(1-methylethyl)-N-[(3R)-1-methyl-3-pyrrolidinyl]acetamide
Description:
2-Chloro-N-(1-methylethyl)-N-[(3R)-1-methyl-3-pyrrolidinyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a pyrrolidine moiety. This compound features a chloro group attached to a carbon atom adjacent to an acetamide functional group, contributing to its reactivity and potential biological activity. The presence of the isopropyl group (1-methylethyl) and the chiral pyrrolidine ring adds complexity to its stereochemistry, which may influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific arrangement of atoms and functional groups suggests that it may interact with biological targets, making it of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity would be influenced by its molecular structure, which are critical factors in determining its utility in various chemical and biological contexts.
Formula:C10H19ClN2O
InChI:InChI=1S/C10H19ClN2O/c1-8(2)13(10(14)6-11)9-4-5-12(3)7-9/h8-9H,4-7H2,1-3H3/t9-/m1/s1
InChI key:InChIKey=IYQVDPIBAMQYFD-SECBINFHSA-N
SMILES:N(C(CCl)=O)(C(C)C)[C@H]1CN(C)CC1
Synonyms:- Acetamide, 2-chloro-N-(1-methylethyl)-N-[(3R)-1-methyl-3-pyrrolidinyl]-
- 2-Chloro-N-(1-methylethyl)-N-[(3R)-1-methyl-3-pyrrolidinyl]acetamide
- 2-Chloro-N-isopropyl-N-((S)-1-Methyl-pyrrolidin-3-yl)-acetaMide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.