CAS 1354004-64-0

1-(1,1-Dimethylethyl) (3S)-3-[(carboxymethyl)cyclopropylamino]-1-piperidinecarboxylate

Description:

1-(1,1-Dimethylethyl) (3S)-3-[(carboxymethyl)cyclopropylamino]-1-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a cyclopropyl group, and a carboxymethyl substituent. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its hydrophobic characteristics, while the carboxymethyl group enhances its solubility in polar solvents. This compound is likely to exhibit biological activity due to the presence of the amino group, which can participate in hydrogen bonding and interactions with biological targets. Its stereochemistry, indicated by the (3S) designation, suggests that it may have specific interactions in biological systems, potentially influencing its pharmacological properties. The molecular weight and specific reactivity would depend on the functional groups present, making it a candidate for various applications in medicinal chemistry and drug design. Overall, this compound's unique structural features may contribute to its potential utility in therapeutic contexts.

Formula: C₁₅H₂₆N₂O₄

InChI: InChI=1S/C15H26N2O4/c1-15(2,3)21-14(20)16-8-4-5-12(9-16)17(10-13(18)19)11-6-7-11/h11-12H,4-10H2,1-3H3,(H,18,19)/t12-/m0/s1

InChI key: InChIKey=FXOURPOPDOQWCP-LBPRGKRZSA-N

SMILES: N(CC(O)=O)([C@@H]1CN(C(OC(C)(C)C)=O)CCC1)C2CC2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[(carboxymethyl)cyclopropylamino]-, 1-(1,1-dimethylethyl) ester, (3S)-
• 1-(1,1-Dimethylethyl) (3S)-3-[(carboxymethyl)cyclopropylamino]-1-piperidinecarboxylate