CymitQuimica logo

CAS 1354006-67-9

:

(2S)-2-Amino-N-cyclopropyl-N-[(3-methoxyphenyl)methyl]propanamide

Description:
(2S)-2-Amino-N-cyclopropyl-N-[(3-methoxyphenyl)methyl]propanamide, with the CAS number 1354006-67-9, is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group, which contributes to its basicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The cyclopropyl group introduces ring strain, which can influence the compound's reactivity and conformational flexibility. The presence of the methoxyphenyl moiety adds to its hydrophobic character and may enhance interactions with biological targets, making it of interest in medicinal chemistry. This compound is likely to exhibit specific pharmacological properties, potentially acting as a ligand for certain receptors or enzymes. Its structural complexity suggests that it may undergo various chemical reactions, including acylation or substitution, depending on the conditions. Overall, the unique combination of functional groups and stereochemistry in (2S)-2-Amino-N-cyclopropyl-N-[(3-methoxyphenyl)methyl]propanamide contributes to its potential applications in drug development and research.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-10(15)14(17)16(12-6-7-12)9-11-4-3-5-13(8-11)18-2/h3-5,8,10,12H,6-7,9,15H2,1-2H3/t10-/m0/s1
InChI key:InChIKey=AIUSRKFXHCZJFV-JTQLQIEISA-N
SMILES:N(CC1=CC(OC)=CC=C1)(C([C@H](C)N)=O)C2CC2
Synonyms:
  • (2S)-2-Amino-N-cyclopropyl-N-[(3-methoxyphenyl)methyl]propanamide
  • Propanamide, 2-amino-N-cyclopropyl-N-[(3-methoxyphenyl)methyl]-, (2S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.