CymitQuimica logo

CAS 1354006-77-1

:

N-[(3R)-1-(2-Chloroacetyl)-3-piperidinyl]-N-cyclopropylacetamide

Description:
N-[(3R)-1-(2-Chloroacetyl)-3-piperidinyl]-N-cyclopropylacetamide is a chemical compound characterized by its unique structural features, which include a piperidine ring and a cyclopropyl group. The presence of a chloroacetyl moiety suggests potential reactivity and biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit specific pharmacological properties due to its ability to interact with biological targets, potentially influencing neurotransmitter systems or other cellular pathways. The stereochemistry indicated by the (3R) configuration suggests that the compound may have distinct enantiomeric forms, which can lead to variations in biological activity. Additionally, the presence of both polar and non-polar functional groups in its structure may influence its solubility, permeability, and overall bioavailability. As with many compounds in drug development, understanding its physicochemical properties, such as melting point, solubility, and stability, is crucial for assessing its potential therapeutic applications. Further studies would be necessary to elucidate its complete profile and potential uses in pharmacology.
Formula:C12H19ClN2O2
InChI:InChI=1S/C12H19ClN2O2/c1-9(16)15(10-4-5-10)11-3-2-6-14(8-11)12(17)7-13/h10-11H,2-8H2,1H3/t11-/m1/s1
InChI key:InChIKey=NIHXMWHXFHGKPC-LLVKDONJSA-N
SMILES:N(C(C)=O)([C@H]1CN(C(CCl)=O)CCC1)C2CC2
Synonyms:
  • N-[(3R)-1-(2-Chloroacetyl)-3-piperidinyl]-N-cyclopropylacetamide
  • Acetamide, N-[(3R)-1-(2-chloroacetyl)-3-piperidinyl]-N-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.