CymitQuimica logo

CAS 1354008-92-6

:

N-[[(2S)-1-(2-Aminoacetyl)-2-pyrrolidinyl]methyl]-N-ethylacetamide

Description:
N-[[(2S)-1-(2-Aminoacetyl)-2-pyrrolidinyl]methyl]-N-ethylacetamide, with the CAS number 1354008-92-6, is a chemical compound characterized by its specific structural features, including a pyrrolidine ring and an acetamide functional group. This compound is typically classified as an amide due to the presence of the acetamide moiety, which contributes to its potential biological activity. The presence of the aminoacetyl group suggests that it may participate in various biochemical interactions, possibly influencing protein synthesis or enzyme activity. The stereochemistry indicated by the (2S) designation implies that the compound has a specific three-dimensional arrangement, which can significantly affect its reactivity and interaction with biological targets. Additionally, the ethyl group attached to the nitrogen atom may enhance lipophilicity, potentially influencing its pharmacokinetic properties. Overall, this compound's unique structural characteristics may render it of interest in medicinal chemistry and drug development, particularly in the context of neuropharmacology or related fields.
Formula:C11H21N3O2
InChI:InChI=1S/C11H21N3O2/c1-3-13(9(2)15)8-10-5-4-6-14(10)11(16)7-12/h10H,3-8,12H2,1-2H3/t10-/m0/s1
InChI key:InChIKey=SVEZVBLRXXCDGQ-JTQLQIEISA-N
SMILES:C(N(C(C)=O)CC)[C@H]1N(C(CN)=O)CCC1
Synonyms:
  • N-[[(2S)-1-(2-Aminoacetyl)-2-pyrrolidinyl]methyl]-N-ethylacetamide
  • Acetamide, N-[[(2S)-1-(2-aminoacetyl)-2-pyrrolidinyl]methyl]-N-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.