CAS 1354009-10-1
:N-[1-[(2S)-2-Amino-1-oxopropyl]-4-piperidinyl]acetamide
Description:
N-[1-[(2S)-2-Amino-1-oxopropyl]-4-piperidinyl]acetamide, with the CAS number 1354009-10-1, is a chemical compound characterized by its structural features that include a piperidine ring and an acetamide functional group. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where it may serve as a pharmacological agent. The presence of the amino acid moiety contributes to its ability to interact with biological targets, potentially influencing various physiological processes. The stereochemistry indicated by the (2S) designation suggests that it has specific spatial arrangements that can affect its biological interactions and efficacy. Additionally, the compound's solubility, stability, and reactivity are influenced by its functional groups, making it a subject of interest for further research in drug development and therapeutic applications. Overall, this compound exemplifies the complexity and diversity of chemical substances used in the field of biochemistry and pharmacology.
Formula:C10H19N3O2
InChI:InChI=1S/C10H19N3O2/c1-7(11)10(15)13-5-3-9(4-6-13)12-8(2)14/h7,9H,3-6,11H2,1-2H3,(H,12,14)/t7-/m0/s1
InChI key:InChIKey=MWUAKGBSRKFXJX-ZETCQYMHSA-N
SMILES:C([C@H](C)N)(=O)N1CCC(NC(C)=O)CC1
Synonyms:- N-[1-[(2S)-2-Amino-1-oxopropyl]-4-piperidinyl]acetamide
- Acetamide, N-[1-[(2S)-2-amino-1-oxopropyl]-4-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.