CAS 1354009-16-7

(2S)-2-Amino-N-[(6-chloro-3-pyridazinyl)methyl]propanamide

Description:

(2S)-2-Amino-N-[(6-chloro-3-pyridazinyl)methyl]propanamide is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group (-NH2) and an amide group (-C(=O)NH-) attached to a propanamide backbone, indicating its potential as a biologically active molecule. The presence of a pyridazine ring, specifically substituted with a chlorine atom at the 6-position, suggests that this compound may exhibit unique pharmacological properties, possibly influencing its interaction with biological targets. The chirality at the 2-position (2S) indicates that it exists as a specific enantiomer, which can significantly affect its biological activity and efficacy. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its structural features that could facilitate interactions with various biological systems. Its solubility, stability, and reactivity would depend on the specific conditions and environment in which it is studied.

Formula: C₈H₁₁ClN₄O

InChI: InChI=1S/C8H11ClN4O/c1-5(10)8(14)11-4-6-2-3-7(9)13-12-6/h2-3,5H,4,10H2,1H3,(H,11,14)/t5-/m0/s1

InChI key: InChIKey=VVGLUORTCVTVIP-YFKPBYRVSA-N

SMILES: C(NC([C@H](C)N)=O)C1=CC=C(Cl)N=N1

Synonyms:

• (2S)-2-Amino-N-[(6-chloro-3-pyridazinyl)methyl]propanamide
• Propanamide, 2-amino-N-[(6-chloro-3-pyridazinyl)methyl]-, (2S)-