CAS 1354009-38-3

(2S)-2-Amino-N-[4-(cyclopropylmethylamino)cyclohexyl]propanamide

Description:

(2S)-2-Amino-N-[4-(cyclopropylmethylamino)cyclohexyl]propanamide, identified by its CAS number 1354009-38-3, is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group (-NH2) and an amide linkage, which contribute to its potential biological activity. The presence of a cyclopropylmethylamino group attached to a cyclohexyl ring indicates a complex structure that may influence its pharmacological properties, such as receptor binding and activity. The compound's stereochemistry, denoted by the (2S) configuration, suggests that it may exhibit chirality, which can significantly affect its interactions in biological systems. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its solubility, stability, and reactivity would depend on the surrounding environment, including pH and temperature, which are critical factors in its application and study. Overall, this compound represents a unique structure with potential implications in drug design and therapeutic applications.

Formula: C₁₃H₂₅N₃O

InChI: InChI=1S/C13H25N3O/c1-9(14)13(17)15-10-3-5-11(6-4-10)16(2)12-7-8-12/h9-12H,3-8,14H2,1-2H3,(H,15,17)/t9-,10?,11?/m0/s1

InChI key: InChIKey=ZEKNMOYSTCUUIH-WHXUTIOJSA-N

SMILES: N(C)(C1CC1)C2CCC(NC([C@H](C)N)=O)CC2

Synonyms:

• (2S)-2-Amino-N-[4-(cyclopropylmethylamino)cyclohexyl]propanamide
• Propanamide, 2-amino-N-[4-(cyclopropylmethylamino)cyclohexyl]-, (2S)-