CAS 1354009-72-5
:(3S)-3-[Cyclopropyl(phenylmethyl)amino]-1-piperidineethanol
Description:
The chemical substance known as (3S)-3-[Cyclopropyl(phenylmethyl)amino]-1-piperidineethanol, with the CAS number 1354009-72-5, is a compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a cyclopropyl group and a phenylmethyl group attached to the nitrogen atom of the piperidine, indicating potential for unique steric and electronic properties. The (3S) designation suggests that it has a specific stereochemistry at the chiral center, which can significantly influence its biological activity and interactions. The presence of the ethanol moiety indicates that it has hydroxyl functional groups, which can enhance solubility in polar solvents and may also participate in hydrogen bonding. Such structural features suggest that this compound could exhibit interesting pharmacological properties, potentially acting as a ligand for various biological targets. However, detailed studies would be necessary to fully elucidate its behavior and applications in medicinal chemistry or related fields.
Formula:C17H26N2O
InChI:InChI=1S/C17H26N2O/c20-12-11-18-10-4-7-17(14-18)19(16-8-9-16)13-15-5-2-1-3-6-15/h1-3,5-6,16-17,20H,4,7-14H2/t17-/m0/s1
InChI key:InChIKey=JXRXSROUZBNDSX-KRWDZBQOSA-N
SMILES:N(CC1=CC=CC=C1)([C@@H]2CN(CCO)CCC2)C3CC3
Synonyms:- 1-Piperidineethanol, 3-[cyclopropyl(phenylmethyl)amino]-, (3S)-
- (3S)-3-[Cyclopropyl(phenylmethyl)amino]-1-piperidineethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.