CAS 1354009-98-5
:(2S)-2-Amino-N-[(6-methoxy-3-pyridazinyl)methyl]-3-methyl-N-(1-methylethyl)butanamide
Description:
(2S)-2-Amino-N-[(6-methoxy-3-pyridazinyl)methyl]-3-methyl-N-(1-methylethyl)butanamide is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group, which contributes to its basicity and potential for forming hydrogen bonds. The presence of a pyridazine ring, substituted with a methoxy group, indicates potential for aromatic interactions and may influence its biological activity. The butanamide structure suggests it has a carboxamide functional group, which can enhance solubility in polar solvents. The compound's chiral center at the second carbon atom (2S configuration) implies that it may exhibit different biological activities compared to its enantiomer. Additionally, the presence of a branched alkyl group (1-methylethyl) and a methyl group contributes to its steric properties, potentially affecting its interaction with biological targets. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its complex structure and potential for specific interactions with biological molecules.
Formula:C14H24N4O2
InChI:InChI=1S/C14H24N4O2/c1-9(2)13(15)14(19)18(10(3)4)8-11-6-7-12(20-5)17-16-11/h6-7,9-10,13H,8,15H2,1-5H3/t13-/m0/s1
InChI key:InChIKey=YVQVZVWDNTYSMT-ZDUSSCGKSA-N
SMILES:C(N(C([C@H](C(C)C)N)=O)C(C)C)C1=CC=C(OC)N=N1
Synonyms:- (2S)-2-Amino-N-[(6-methoxy-3-pyridazinyl)methyl]-3-methyl-N-(1-methylethyl)butanamide
- Butanamide, 2-amino-N-[(6-methoxy-3-pyridazinyl)methyl]-3-methyl-N-(1-methylethyl)-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.