
CAS 135401-18-2
:N-Ethyl-5-methyl-3-isoxazolecarboxamide
Description:
N-Ethyl-5-methyl-3-isoxazolecarboxamide, identified by its CAS number 135401-18-2, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features an ethyl group and a methyl group attached to the isoxazole ring, contributing to its unique chemical properties. It is typically classified as an amide due to the presence of the carboxamide functional group, which influences its solubility and reactivity. The presence of the isoxazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry and drug development. N-Ethyl-5-methyl-3-isoxazolecarboxamide may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects and potential applications. Its stability, melting point, and solubility characteristics would depend on the specific conditions and solvents used in experimentation. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-3-8-7(10)6-4-5(2)11-9-6/h4H,3H2,1-2H3,(H,8,10)
InChI key:InChIKey=MSPILAPTSCOXIG-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C1=NOC(C)=C1
Synonyms:- 3-Isoxazolecarboxamide, N-ethyl-5-methyl-
- N-Ethyl-5-methyl-3-isoxazolecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.