CymitQuimica logo

CAS 1354010-60-8

:

(3S)-3-Iodo-1-methylpyrrolidine

Description:
(3S)-3-Iodo-1-methylpyrrolidine is a chiral organic compound characterized by its five-membered pyrrolidine ring, which contains a methyl group and an iodine substituent at the 3-position. The presence of the iodine atom introduces significant reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in the development of pharmaceuticals and agrochemicals. The compound's chirality, denoted by the (3S) configuration, indicates that it exists as one specific enantiomer, which can exhibit distinct biological activities compared to its mirror image. This specificity is crucial in medicinal chemistry, where the efficacy and safety of a drug can be highly dependent on its stereochemistry. Additionally, (3S)-3-Iodo-1-methylpyrrolidine may participate in nucleophilic substitution reactions due to the presence of the iodine atom, which can be displaced under appropriate conditions. Overall, this compound serves as an important building block in synthetic organic chemistry, with applications in various fields, including medicinal chemistry and materials science.
Formula:C5H10IN
InChI:InChI=1S/C5H10IN/c1-7-3-2-5(6)4-7/h5H,2-4H2,1H3/t5-/m0/s1
InChI key:InChIKey=JRYHSOYEKJWMIB-YFKPBYRVSA-N
SMILES:I[C@@H]1CN(C)CC1
Synonyms:
  • (3S)-3-Iodo-1-methylpyrrolidine
  • Pyrrolidine, 3-iodo-1-methyl-, (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.