CAS 1354011-07-6
:(3R)-N-Methyl-1-(phenylmethyl)-3-piperidinamine
Description:
(3R)-N-Methyl-1-(phenylmethyl)-3-piperidinamine, identified by its CAS number 1354011-07-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The compound features a methyl group attached to the nitrogen atom of the piperidine, contributing to its basicity and potential for forming salts. The presence of a phenylmethyl group enhances its lipophilicity, which may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. As a chiral molecule, it exhibits stereoisomerism, with the (3R) configuration indicating the specific spatial arrangement of its atoms, which can significantly affect its biological activity and interaction with receptors. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the structural similarities to other psychoactive agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure and purity.
Formula:C13H20N2
InChI:InChI=1S/C13H20N2/c1-14-13-8-5-9-15(11-13)10-12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-11H2,1H3/t13-/m1/s1
InChI key:InChIKey=XYFAEHZVQWTOPH-CYBMUJFWSA-N
SMILES:C(N1C[C@H](NC)CCC1)C2=CC=CC=C2
Synonyms:- (3R)-N-Methyl-1-(phenylmethyl)-3-piperidinamine
- (3R)-N-Methyl-1-(phenylmethyl)-3-Piperidinamine
- (3R)-1-Benzyl-N-methylpiperidin-3-amine
- 3-Piperidinamine, N-methyl-1-(phenylmethyl)-, (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.