CAS 1354011-08-7

Phenylmethyl (3S)-3-[(2-aminoacetyl)(1-methylethyl)amino]-1-piperidinecarboxylate

Description:

Phenylmethyl (3S)-3-[(2-aminoacetyl)(1-methylethyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1354011-08-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring, an amino acid derivative, and an ester functional group. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of amino and carboxylate groups. The stereochemistry indicated by the (3S) designation suggests specific spatial arrangements that can influence its biological activity and interactions. As a derivative of piperidine, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The presence of the phenylmethyl group can enhance lipophilicity, potentially affecting its permeability and distribution in biological systems. Overall, this compound's unique structural features contribute to its potential applications in drug development and biochemical research.

Formula: C₁₈H₂₇N₃O₃

InChI: InChI=1S/C18H27N3O3/c1-14(2)21(17(22)11-19)16-9-6-10-20(12-16)18(23)24-13-15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,9-13,19H2,1-2H3/t16-/m0/s1

InChI key: InChIKey=KTBYPKYWTOUDFF-INIZCTEOSA-N

SMILES: N(C(CN)=O)(C(C)C)[C@@H]1CN(C(OCC2=CC=CC=C2)=O)CCC1

Synonyms:

• Phenylmethyl (3S)-3-[(2-aminoacetyl)(1-methylethyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[(2-aminoacetyl)(1-methylethyl)amino]-, phenylmethyl ester, (3S)-