CAS 1354011-25-8

1-(Phenylmethyl) (3S)-3-[(carboxymethyl)(1-methylethyl)amino]-1-pyrrolidinecarboxylate

Description:

1-(Phenylmethyl) (3S)-3-[(carboxymethyl)(1-methylethyl)amino]-1-pyrrolidinecarboxylate, identified by its CAS number 1354011-25-8, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring substituted with various functional groups. The presence of a phenylmethyl group indicates aromatic characteristics, while the carboxymethyl and isopropylamino substituents suggest potential for biological activity, possibly influencing interactions with biological targets. This compound may exhibit properties typical of amino acids or peptides due to its amino and carboxyl functional groups, which could facilitate hydrogen bonding and solubility in polar solvents. Its stereochemistry, denoted by the (3S) configuration, implies specific spatial arrangements that could affect its reactivity and interaction with enzymes or receptors. Overall, the compound's unique combination of functional groups and stereochemistry may contribute to its potential applications in pharmaceuticals or biochemistry, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₇H₂₄N₂O₄

InChI: InChI=1S/C17H24N2O4/c1-13(2)19(11-16(20)21)15-8-9-18(10-15)17(22)23-12-14-6-4-3-5-7-14/h3-7,13,15H,8-12H2,1-2H3,(H,20,21)/t15-/m0/s1

InChI key: InChIKey=ITURZCZTENGWGN-HNNXBMFYSA-N

SMILES: N(CC(O)=O)(C(C)C)[C@@H]1CN(C(OCC2=CC=CC=C2)=O)CC1

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-[(carboxymethyl)(1-methylethyl)amino]-, 1-(phenylmethyl) ester, (3S)-
• 1-(Phenylmethyl) (3S)-3-[(carboxymethyl)(1-methylethyl)amino]-1-pyrrolidinecarboxylate