CymitQuimica logo

CAS 1354016-68-4

:

1-[(2S)-2-[[(2-Aminoethyl)cyclopropylamino]methyl]-1-pyrrolidinyl]ethanone

Description:
1-[(2S)-2-[[(2-Aminoethyl)cyclopropylamino]methyl]-1-pyrrolidinyl]ethanone, with the CAS number 1354016-68-4, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a cyclopropyl group. This substance is typically classified as a small organic molecule and may exhibit properties relevant to pharmacology, particularly in the context of neurochemistry or medicinal chemistry. The presence of an amino group suggests potential interactions with biological systems, possibly influencing neurotransmitter pathways or receptor activity. Its stereochemistry, indicated by the (2S) configuration, implies specific spatial arrangements that can significantly affect its biological activity and binding affinity. Additionally, the ethanone moiety indicates that it may participate in various chemical reactions, including acylation or condensation. Overall, this compound's unique structural features may contribute to its potential applications in drug development or as a research tool in understanding complex biological processes.
Formula:C12H23N3O
InChI:InChI=1S/C12H23N3O/c1-10(16)15-7-2-3-12(15)9-14(8-6-13)11-4-5-11/h11-12H,2-9,13H2,1H3/t12-/m0/s1
InChI key:InChIKey=MIXYAWTXSYBGIJ-LBPRGKRZSA-N
SMILES:C(N(CCN)C1CC1)[C@H]2N(C(C)=O)CCC2
Synonyms:
  • 1-[(2S)-2-[[(2-Aminoethyl)cyclopropylamino]methyl]-1-pyrrolidinyl]ethanone
  • Ethanone, 1-[(2S)-2-[[(2-aminoethyl)cyclopropylamino]methyl]-1-pyrrolidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.