CAS 1354017-21-2
:2-Amino-N-cyclopropyl-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]acetamide
Description:
2-Amino-N-cyclopropyl-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]acetamide is a chemical compound characterized by its complex structure, which includes an amino group, a cyclopropyl moiety, and a piperidine ring. This compound is typically classified as an amide due to the presence of the acetamide functional group. It exhibits potential pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutics targeting various neurological conditions. The stereochemistry indicated by the (3R) designation suggests that the compound has specific spatial arrangements that may influence its biological activity and interaction with receptors. Additionally, the presence of the phenylmethyl group contributes to its lipophilicity, which can affect its absorption and distribution in biological systems. Overall, this compound's unique structural features and potential biological activities make it a subject of interest for further research and development in pharmaceutical applications.
Formula:C17H25N3O
InChI:InChI=1S/C17H25N3O/c18-11-17(21)20(15-8-9-15)16-7-4-10-19(13-16)12-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13,18H2/t16-/m1/s1
InChI key:InChIKey=NPGBTYVYFSQFSI-MRXNPFEDSA-N
SMILES:N(C(CN)=O)([C@H]1CN(CC2=CC=CC=C2)CCC1)C3CC3
Synonyms:- 2-Amino-N-cyclopropyl-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]acetamide
- Acetamide, 2-amino-N-cyclopropyl-N-[(3R)-1-(phenylmethyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.