CAS 1354017-32-5
:N-[(3S)-1-Acetyl-3-piperidinyl]-N-ethylglycine
Description:
N-[(3S)-1-Acetyl-3-piperidinyl]-N-ethylglycine, with the CAS number 1354017-32-5, is a chemical compound that belongs to the class of amino acids and derivatives. It features a piperidine ring, which contributes to its cyclic structure and potential biological activity. The presence of an acetyl group indicates that it may participate in various chemical reactions, including acylation and esterification. The ethylglycine moiety suggests that it possesses both hydrophilic and lipophilic characteristics, which can influence its solubility and permeability in biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its stereochemistry, particularly the (3S) configuration, is crucial for its biological activity, as stereoisomers can have significantly different effects in biological systems. Overall, N-[(3S)-1-Acetyl-3-piperidinyl]-N-ethylglycine is a structurally complex molecule with potential applications in pharmaceuticals and biochemistry.
Formula:C11H20N2O3
InChI:InChI=1S/C11H20N2O3/c1-3-12(8-11(15)16)10-5-4-6-13(7-10)9(2)14/h10H,3-8H2,1-2H3,(H,15,16)/t10-/m0/s1
InChI key:InChIKey=JAACYQDMIVWOOF-JTQLQIEISA-N
SMILES:N(CC(O)=O)(CC)[C@@H]1CN(C(C)=O)CCC1
Synonyms:- Glycine, N-[(3S)-1-acetyl-3-piperidinyl]-N-ethyl-
- N-[(3S)-1-Acetyl-3-piperidinyl]-N-ethylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.